C7H12N4S — CID 65275516
1-N-(1,2,4-thiadiazol-5-yl)cyclopentane-1,2-diamine (PubChem CID 65275516) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is 1-N-(1,2,4-thiadiazol-5-yl)cyclopentane-1,2-diamine.
| Compound Name | 1-N-(1,2,4-thiadiazol-5-yl)cyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 65275516 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 1-N-(1,2,4-thiadiazol-5-yl)cyclopentane-1,2-diamine |
| SMILES | NC1CCCC1Nc1ncns1 |
| InChI | InChI=1S/C7H12N4S/c8-5-2-1-3-6(5)11-7-9-4-10-12-7/h4-6H,1-3,8H2,(H,9,10,11) |
| InChIKey | CPGZYFSEBLJCPA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |