C8H7ClN4S — CID 65275930
4-chloro-3-N-(1,2,4-thiadiazol-5-yl)benzene-1,3-diamine (PubChem CID 65275930) has the molecular formula C8H7ClN4S and a molecular weight of 226.69 g/mol. Its IUPAC name is 4-chloro-3-N-(1,2,4-thiadiazol-5-yl)benzene-1,3-diamine.
| Compound Name | 4-chloro-3-N-(1,2,4-thiadiazol-5-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 65275930 |
| Molecular Formula | C8H7ClN4S |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 4-chloro-3-N-(1,2,4-thiadiazol-5-yl)benzene-1,3-diamine |
| SMILES | Nc1ccc(Cl)c(Nc2ncns2)c1 |
| InChI | InChI=1S/C8H7ClN4S/c9-6-2-1-5(10)3-7(6)13-8-11-4-12-14-8/h1-4H,10H2,(H,11,12,13) |
| InChIKey | YERVXQLCUNUTGR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|