About 2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol
2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol (PubChem CID 65276029) has the molecular formula C9H8N2O2S
and a molecular weight of 208.24 g/mol. Its IUPAC name is 2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol.
Molecular Properties
| Compound Name | 2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol |
| PubChem CID | 65276029 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol |
| SMILES | Cc1c(O)cccc1Oc1ncns1 |
| InChI | InChI=1S/C9H8N2O2S/c1-6-7(12)3-2-4-8(6)13-9-10-5-11-14-9/h2-5,12H,1H3 |
| InChIKey | SZWATNMOJIDQAH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol?
The IUPAC name of 2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol (CID 65276029) is 2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol.
What is the SMILES notation for 2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol?
The canonical SMILES for 2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol is Cc1c(O)cccc1Oc1ncns1.
What is the InChIKey of 2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol?
The InChIKey is SZWATNMOJIDQAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S/c1-6-7(12)3-2-4-8(6)13-9-10-5-11-14-9/h2-5,12H,1H3.
What are the key properties of 2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol?
2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol has a molecular weight of 208.24 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(1,2,4-thiadiazol-5-yloxy)phenol is sourced from PubChem (CID 65276029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).