C10H14ClN3S — CID 65277411
N-(2-chloro-2-cyclopropylethyl)-3-cyclopropyl-1,2,4-thiadiazol-5-amine (PubChem CID 65277411) has the molecular formula C10H14ClN3S and a molecular weight of 243.76 g/mol. Its IUPAC name is N-(2-chloro-2-cyclopropylethyl)-3-cyclopropyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-chloro-2-cyclopropylethyl)-3-cyclopropyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65277411 |
| Molecular Formula | C10H14ClN3S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | N-(2-chloro-2-cyclopropylethyl)-3-cyclopropyl-1,2,4-thiadiazol-5-amine |
| SMILES | ClC(CNc1nc(C2CC2)ns1)C1CC1 |
| InChI | InChI=1S/C10H14ClN3S/c11-8(6-1-2-6)5-12-10-13-9(14-15-10)7-3-4-7/h6-8H,1-5H2,(H,12,13,14) |
| InChIKey | OWVANHOJAKTSLX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|