About N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine
N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine (PubChem CID 65277512) has the molecular formula C9H14ClN3S
and a molecular weight of 231.75 g/mol. Its IUPAC name is N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine |
| PubChem CID | 65277512 |
| Molecular Formula | C9H14ClN3S |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCN(CCCl)c1nc(C2CC2)ns1 |
| InChI | InChI=1S/C9H14ClN3S/c1-2-13(6-5-10)9-11-8(12-14-9)7-3-4-7/h7H,2-6H2,1H3 |
| InChIKey | AOAXEZJBKWTMRW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine?
The IUPAC name of N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine (CID 65277512) is N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine?
The canonical SMILES for N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine is CCN(CCCl)c1nc(C2CC2)ns1.
What is the InChIKey of N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine?
The InChIKey is AOAXEZJBKWTMRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClN3S/c1-2-13(6-5-10)9-11-8(12-14-9)7-3-4-7/h7H,2-6H2,1H3.
What are the key properties of N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine?
N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine has a molecular weight of 231.75 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroethyl)-3-cyclopropyl-N-ethyl-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 65277512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).