C9H16ClN3S — CID 65278099
N-(2-chloropropyl)-N-methyl-3-propan-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 65278099) has the molecular formula C9H16ClN3S and a molecular weight of 233.77 g/mol. Its IUPAC name is N-(2-chloropropyl)-N-methyl-3-propan-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-chloropropyl)-N-methyl-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65278099 |
| Molecular Formula | C9H16ClN3S |
| Molecular Weight | 233.77 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N-(2-chloropropyl)-N-methyl-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CC(Cl)CN(C)c1nc(C(C)C)ns1 |
| InChI | InChI=1S/C9H16ClN3S/c1-6(2)8-11-9(14-12-8)13(4)5-7(3)10/h6-7H,5H2,1-4H3 |
| InChIKey | ATVMBJONMKXQSQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.77 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|