C12H12Br2OS — CID 65278348
3-[bromo-(3-bromo-5-methylthiophen-2-yl)methyl]-2,5-dimethylfuran (PubChem CID 65278348) has the molecular formula C12H12Br2OS and a molecular weight of 364.10 g/mol. Its IUPAC name is 3-[bromo-(3-bromo-5-methylthiophen-2-yl)methyl]-2,5-dimethylfuran.
| Compound Name | 3-[bromo-(3-bromo-5-methylthiophen-2-yl)methyl]-2,5-dimethylfuran |
|---|---|
| PubChem CID | 65278348 |
| Molecular Formula | C12H12Br2OS |
| Molecular Weight | 364.10 g/mol |
| Exact Mass | 361.90 |
| IUPAC Name | 3-[bromo-(3-bromo-5-methylthiophen-2-yl)methyl]-2,5-dimethylfuran |
| SMILES | Cc1cc(C(Br)c2sc(C)cc2Br)c(C)o1 |
| InChI | InChI=1S/C12H12Br2OS/c1-6-4-9(8(3)15-6)11(14)12-10(13)5-7(2)16-12/h4-5,11H,1-3H3 |
| InChIKey | UZRURFUQFPPBKP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.10 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|