C17H28BrNS — CID 65279032
1-(3-bromo-5-methylthiophen-2-yl)-1-(4-butylcyclohexyl)-N-methylmethanamine (PubChem CID 65279032) has the molecular formula C17H28BrNS and a molecular weight of 358.39 g/mol. Its IUPAC name is 1-(3-bromo-5-methylthiophen-2-yl)-1-(4-butylcyclohexyl)-N-methylmethanamine.
| Compound Name | 1-(3-bromo-5-methylthiophen-2-yl)-1-(4-butylcyclohexyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 65279032 |
| Molecular Formula | C17H28BrNS |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-(3-bromo-5-methylthiophen-2-yl)-1-(4-butylcyclohexyl)-N-methylmethanamine |
| SMILES | CCCCC1CCC(C(NC)c2sc(C)cc2Br)CC1 |
| InChI | InChI=1S/C17H28BrNS/c1-4-5-6-13-7-9-14(10-8-13)16(19-3)17-15(18)11-12(2)20-17/h11,13-14,16,19H,4-10H2,1-3H3 |
| InChIKey | HAAAJEQSLVUEIC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |