C12H22N4OS — CID 65279971
N-[[1-(3-ethyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-yl]methyl]-2-methoxyethanamine (PubChem CID 65279971) has the molecular formula C12H22N4OS and a molecular weight of 270.40 g/mol. Its IUPAC name is N-[[1-(3-ethyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-(3-ethyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 65279971 |
| Molecular Formula | C12H22N4OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-[[1-(3-ethyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-yl]methyl]-2-methoxyethanamine |
| SMILES | CCc1nsc(N2CCCC2CNCCOC)n1 |
| InChI | InChI=1S/C12H22N4OS/c1-3-11-14-12(18-15-11)16-7-4-5-10(16)9-13-6-8-17-2/h10,13H,3-9H2,1-2H3 |
| InChIKey | NUANSYBQGHBZMZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|