About (4-methylphenyl) diphenyl phosphate
(4-methylphenyl) diphenyl phosphate (PubChem CID 6528) has the molecular formula C19H17O4P
and a molecular weight of 340.32 g/mol. Its IUPAC name is (4-methylphenyl) diphenyl phosphate.
Molecular Properties
| Compound Name | (4-methylphenyl) diphenyl phosphate |
| PubChem CID | 6528 |
| Molecular Formula | C19H17O4P |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (4-methylphenyl) diphenyl phosphate |
| SMILES | Cc1ccc(OP(=O)(Oc2ccccc2)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H17O4P/c1-16-12-14-19(15-13-16)23-24(20,21-17-8-4-2-5-9-17)22-18-10-6-3-7-11-18/h2-15H,1H3 |
| InChIKey | OJUZRFGUKHQNJX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) diphenyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) diphenyl phosphate?
The IUPAC name of (4-methylphenyl) diphenyl phosphate (CID 6528) is (4-methylphenyl) diphenyl phosphate.
What is the SMILES notation for (4-methylphenyl) diphenyl phosphate?
The canonical SMILES for (4-methylphenyl) diphenyl phosphate is Cc1ccc(OP(=O)(Oc2ccccc2)Oc2ccccc2)cc1.
What is the InChIKey of (4-methylphenyl) diphenyl phosphate?
The InChIKey is OJUZRFGUKHQNJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17O4P/c1-16-12-14-19(15-13-16)23-24(20,21-17-8-4-2-5-9-17)22-18-10-6-3-7-11-18/h2-15H,1H3.
What are the key properties of (4-methylphenyl) diphenyl phosphate?
(4-methylphenyl) diphenyl phosphate has a molecular weight of 340.32 g/mol, XLogP of 5.64, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) diphenyl phosphate is sourced from PubChem (CID 6528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).