About 1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine
1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine (PubChem CID 65280021) has the molecular formula C11H19N3OS
and a molecular weight of 241.36 g/mol. Its IUPAC name is 1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine |
| PubChem CID | 65280021 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine |
| SMILES | CCc1nsc(OCC2(N)CCCCC2)n1 |
| InChI | InChI=1S/C11H19N3OS/c1-2-9-13-10(16-14-9)15-8-11(12)6-4-3-5-7-11/h2-8,12H2,1H3 |
| InChIKey | YFGOBNWWLHHUHX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine?
The IUPAC name of 1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine (CID 65280021) is 1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine.
What is the SMILES notation for 1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine?
The canonical SMILES for 1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine is CCc1nsc(OCC2(N)CCCCC2)n1.
What is the InChIKey of 1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine?
The InChIKey is YFGOBNWWLHHUHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3OS/c1-2-9-13-10(16-14-9)15-8-11(12)6-4-3-5-7-11/h2-8,12H2,1H3.
What are the key properties of 1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine?
1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine has a molecular weight of 241.36 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxymethyl]cyclohexan-1-amine is sourced from PubChem (CID 65280021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).