C10H17BrN2S — CID 65280136
5-(2-bromo-3,3-dimethylbutyl)-3-ethyl-1,2,4-thiadiazole (PubChem CID 65280136) has the molecular formula C10H17BrN2S and a molecular weight of 277.23 g/mol. Its IUPAC name is 5-(2-bromo-3,3-dimethylbutyl)-3-ethyl-1,2,4-thiadiazole.
| Compound Name | 5-(2-bromo-3,3-dimethylbutyl)-3-ethyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 65280136 |
| Molecular Formula | C10H17BrN2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 5-(2-bromo-3,3-dimethylbutyl)-3-ethyl-1,2,4-thiadiazole |
| SMILES | CCc1nsc(CC(Br)C(C)(C)C)n1 |
| InChI | InChI=1S/C10H17BrN2S/c1-5-8-12-9(14-13-8)6-7(11)10(2,3)4/h7H,5-6H2,1-4H3 |
| InChIKey | LCTKOQWFQKWIIZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|