C12H21BrN2S — CID 65280137
5-(2-bromo-3,3-dimethylbutyl)-3-tert-butyl-1,2,4-thiadiazole (PubChem CID 65280137) has the molecular formula C12H21BrN2S and a molecular weight of 305.29 g/mol. Its IUPAC name is 5-(2-bromo-3,3-dimethylbutyl)-3-tert-butyl-1,2,4-thiadiazole.
| Compound Name | 5-(2-bromo-3,3-dimethylbutyl)-3-tert-butyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 65280137 |
| Molecular Formula | C12H21BrN2S |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 5-(2-bromo-3,3-dimethylbutyl)-3-tert-butyl-1,2,4-thiadiazole |
| SMILES | CC(C)(C)c1nsc(CC(Br)C(C)(C)C)n1 |
| InChI | InChI=1S/C12H21BrN2S/c1-11(2,3)8(13)7-9-14-10(15-16-9)12(4,5)6/h8H,7H2,1-6H3 |
| InChIKey | BYAGKTUMOSXSCH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|