About 5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole
5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole (PubChem CID 65280621) has the molecular formula C9H15ClN2OS
and a molecular weight of 234.75 g/mol. Its IUPAC name is 5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole |
| PubChem CID | 65280621 |
| Molecular Formula | C9H15ClN2OS |
| Molecular Weight | 234.75 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole |
| SMILES | COCC(Cl)Cc1nc(C(C)C)ns1 |
| InChI | InChI=1S/C9H15ClN2OS/c1-6(2)9-11-8(14-12-9)4-7(10)5-13-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | BTKFCOMVTJUPGJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.75 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole?
The IUPAC name of 5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole (CID 65280621) is 5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole.
What is the SMILES notation for 5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole?
The canonical SMILES for 5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole is COCC(Cl)Cc1nc(C(C)C)ns1.
What is the InChIKey of 5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole?
The InChIKey is BTKFCOMVTJUPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClN2OS/c1-6(2)9-11-8(14-12-9)4-7(10)5-13-3/h6-7H,4-5H2,1-3H3.
What are the key properties of 5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole?
5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole has a molecular weight of 234.75 g/mol, XLogP of 2.46, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chloro-3-methoxypropyl)-3-propan-2-yl-1,2,4-thiadiazole is sourced from PubChem (CID 65280621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).