C9H12N6S2 — CID 65280653
1-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-1,2,4-triazole-3-carbothioamide (PubChem CID 65280653) has the molecular formula C9H12N6S2 and a molecular weight of 268.37 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 65280653 |
| Molecular Formula | C9H12N6S2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-(3-tert-butyl-1,2,4-thiadiazol-5-yl)-1,2,4-triazole-3-carbothioamide |
| SMILES | CC(C)(C)c1nsc(-n2cnc(C(N)=S)n2)n1 |
| InChI | InChI=1S/C9H12N6S2/c1-9(2,3)7-12-8(17-14-7)15-4-11-6(13-15)5(10)16/h4H,1-3H3,(H2,10,16) |
| InChIKey | UKJVELYMHYXHFI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|