About N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine
N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine (PubChem CID 65280668) has the molecular formula C10H19N3S
and a molecular weight of 213.35 g/mol. Its IUPAC name is N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine.
Molecular Properties
| Compound Name | N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine |
| PubChem CID | 65280668 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine |
| SMILES | CCCc1nsc(C(C)C(C)NC)n1 |
| InChI | InChI=1S/C10H19N3S/c1-5-6-9-12-10(14-13-9)7(2)8(3)11-4/h7-8,11H,5-6H2,1-4H3 |
| InChIKey | YIPQPPKYCPDZCE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine?
The IUPAC name of N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine (CID 65280668) is N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine.
What is the SMILES notation for N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine?
The canonical SMILES for N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine is CCCc1nsc(C(C)C(C)NC)n1.
What is the InChIKey of N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine?
The InChIKey is YIPQPPKYCPDZCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3S/c1-5-6-9-12-10(14-13-9)7(2)8(3)11-4/h7-8,11H,5-6H2,1-4H3.
What are the key properties of N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine?
N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine has a molecular weight of 213.35 g/mol, XLogP of 2.20, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-(3-propyl-1,2,4-thiadiazol-5-yl)butan-2-amine is sourced from PubChem (CID 65280668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).