About 3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one
3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one (PubChem CID 65280720) has the molecular formula C9H14N2OS
and a molecular weight of 198.29 g/mol. Its IUPAC name is 3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one.
Molecular Properties
| Compound Name | 3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one |
| PubChem CID | 65280720 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one |
| SMILES | CC(=O)C(C)c1nc(C(C)C)ns1 |
| InChI | InChI=1S/C9H14N2OS/c1-5(2)8-10-9(13-11-8)6(3)7(4)12/h5-6H,1-4H3 |
| InChIKey | KLUALOUXFCTOTE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one?
The IUPAC name of 3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one (CID 65280720) is 3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one.
What is the SMILES notation for 3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one?
The canonical SMILES for 3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one is CC(=O)C(C)c1nc(C(C)C)ns1.
What is the InChIKey of 3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one?
The InChIKey is KLUALOUXFCTOTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS/c1-5(2)8-10-9(13-11-8)6(3)7(4)12/h5-6H,1-4H3.
What are the key properties of 3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one?
3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one has a molecular weight of 198.29 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)butan-2-one is sourced from PubChem (CID 65280720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).