About 5-(2-bromopropyl)-1,2,4-thiadiazole
5-(2-bromopropyl)-1,2,4-thiadiazole (PubChem CID 65280805) has the molecular formula C5H7BrN2S
and a molecular weight of 207.10 g/mol. Its IUPAC name is 5-(2-bromopropyl)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-(2-bromopropyl)-1,2,4-thiadiazole |
| PubChem CID | 65280805 |
| Molecular Formula | C5H7BrN2S |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 205.95 |
| IUPAC Name | 5-(2-bromopropyl)-1,2,4-thiadiazole |
| SMILES | CC(Br)Cc1ncns1 |
| InChI | InChI=1S/C5H7BrN2S/c1-4(6)2-5-7-3-8-9-5/h3-4H,2H2,1H3 |
| InChIKey | SWDSKFMEUMVFNQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-bromopropyl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-bromopropyl)-1,2,4-thiadiazole?
The IUPAC name of 5-(2-bromopropyl)-1,2,4-thiadiazole (CID 65280805) is 5-(2-bromopropyl)-1,2,4-thiadiazole.
What is the SMILES notation for 5-(2-bromopropyl)-1,2,4-thiadiazole?
The canonical SMILES for 5-(2-bromopropyl)-1,2,4-thiadiazole is CC(Br)Cc1ncns1.
What is the InChIKey of 5-(2-bromopropyl)-1,2,4-thiadiazole?
The InChIKey is SWDSKFMEUMVFNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BrN2S/c1-4(6)2-5-7-3-8-9-5/h3-4H,2H2,1H3.
What are the key properties of 5-(2-bromopropyl)-1,2,4-thiadiazole?
5-(2-bromopropyl)-1,2,4-thiadiazole has a molecular weight of 207.10 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromopropyl)-1,2,4-thiadiazole is sourced from PubChem (CID 65280805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).