About 1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane
1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane (PubChem CID 65280982) has the molecular formula C13H19ClN2O2S
and a molecular weight of 302.83 g/mol. Its IUPAC name is 1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane.
Molecular Properties
| Compound Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane |
| PubChem CID | 65280982 |
| Molecular Formula | C13H19ClN2O2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane |
| SMILES | CC1(C)CCCN(S(=O)(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C13H19ClN2O2S/c1-13(2)6-4-9-16(10-7-13)19(17,18)11-5-3-8-15-12(11)14/h3,5,8H,4,6-7,9-10H2,1-2H3 |
| InChIKey | FGNLWBRPRXPSOX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane?
The IUPAC name of 1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane (CID 65280982) is 1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane.
What is the SMILES notation for 1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane?
The canonical SMILES for 1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane is CC1(C)CCCN(S(=O)(=O)c2cccnc2Cl)CC1.
What is the InChIKey of 1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane?
The InChIKey is FGNLWBRPRXPSOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClN2O2S/c1-13(2)6-4-9-16(10-7-13)19(17,18)11-5-3-8-15-12(11)14/h3,5,8H,4,6-7,9-10H2,1-2H3.
What are the key properties of 1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane?
1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane has a molecular weight of 302.83 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-3-pyridinyl)sulfonyl]-4,4-dimethylazepane is sourced from PubChem (CID 65280982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).