About 4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide
4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide (PubChem CID 65281443) has the molecular formula C14H29N3
and a molecular weight of 239.41 g/mol. Its IUPAC name is 4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide.
Molecular Properties
| Compound Name | 4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide |
| PubChem CID | 65281443 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | 4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCN1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C14H29N3/c1-13(2)6-5-9-17(10-7-13)11-8-14(3,4)12(15)16/h5-11H2,1-4H3,(H3,15,16) |
| InChIKey | HTEUSJWAOHNQLV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide?
The IUPAC name of 4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide (CID 65281443) is 4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide.
What is the SMILES notation for 4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide?
The canonical SMILES for 4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide is [H]/N=C(\N)C(C)(C)CCN1CCCC(C)(C)CC1.
What is the InChIKey of 4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide?
The InChIKey is HTEUSJWAOHNQLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N3/c1-13(2)6-5-9-17(10-7-13)11-8-14(3,4)12(15)16/h5-11H2,1-4H3,(H3,15,16).
What are the key properties of 4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide?
4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide has a molecular weight of 239.41 g/mol, XLogP of 2.85, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylazepan-1-yl)-2,2-dimethylbutanimidamide is sourced from PubChem (CID 65281443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).