C14H24N4 — CID 65281763
[4-[(4,4-dimethylazepan-1-yl)methyl]-2-pyridinyl]hydrazine (PubChem CID 65281763) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is [4-[(4,4-dimethylazepan-1-yl)methyl]-2-pyridinyl]hydrazine.
| Compound Name | [4-[(4,4-dimethylazepan-1-yl)methyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 65281763 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | [4-[(4,4-dimethylazepan-1-yl)methyl]-2-pyridinyl]hydrazine |
| SMILES | CC1(C)CCCN(Cc2ccnc(NN)c2)CC1 |
| InChI | InChI=1S/C14H24N4/c1-14(2)5-3-8-18(9-6-14)11-12-4-7-16-13(10-12)17-15/h4,7,10H,3,5-6,8-9,11,15H2,1-2H3,(H,16,17) |
| InChIKey | XJOFYBFTOBTNIS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|