C18H30N2 — CID 65282253
3-(4,4-dimethylazepan-1-yl)-2-methyl-1-phenylpropan-1-amine (PubChem CID 65282253) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 3-(4,4-dimethylazepan-1-yl)-2-methyl-1-phenylpropan-1-amine.
| Compound Name | 3-(4,4-dimethylazepan-1-yl)-2-methyl-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 65282253 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 3-(4,4-dimethylazepan-1-yl)-2-methyl-1-phenylpropan-1-amine |
| SMILES | CC(CN1CCCC(C)(C)CC1)C(N)c1ccccc1 |
| InChI | InChI=1S/C18H30N2/c1-15(17(19)16-8-5-4-6-9-16)14-20-12-7-10-18(2,3)11-13-20/h4-6,8-9,15,17H,7,10-14,19H2,1-3H3 |
| InChIKey | NPXRYZJSCRQWTO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |