About 2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol
2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol (PubChem CID 65282366) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is 2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol |
| PubChem CID | 65282366 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol |
| SMILES | CC1(C)CCCN(C2CC(C)(C)CCC2O)CC1 |
| InChI | InChI=1S/C16H31NO/c1-15(2)7-5-10-17(11-9-15)13-12-16(3,4)8-6-14(13)18/h13-14,18H,5-12H2,1-4H3 |
| InChIKey | ALSATKNFBKLFLU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol?
The IUPAC name of 2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol (CID 65282366) is 2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol.
What is the SMILES notation for 2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol?
The canonical SMILES for 2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol is CC1(C)CCCN(C2CC(C)(C)CCC2O)CC1.
What is the InChIKey of 2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol?
The InChIKey is ALSATKNFBKLFLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO/c1-15(2)7-5-10-17(11-9-15)13-12-16(3,4)8-6-14(13)18/h13-14,18H,5-12H2,1-4H3.
What are the key properties of 2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol?
2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol has a molecular weight of 253.43 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylazepan-1-yl)-4,4-dimethylcyclohexan-1-ol is sourced from PubChem (CID 65282366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).