2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid

C15H28N2O3 — CID 65282412

IUPAC2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid
SMILESCCCCC(NC(=O)N1CCCC(C)(C)CC1)C(=O)O
InChIInChI=1S/C15H28N2O3/c1-4-5-7-12(13(18)19)16-14(20)17-10-6-8-15(2,3)9-11-17/h12H,4-11H2,1-3H3,(H,16,20)(H,18,19)
InChIKeyDJBNFLLFPNKIMN-UHFFFAOYSA-N
MW284.40 g/mol
LogP2.85
Rot. Bonds5

About 2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid

2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid (PubChem CID 65282412) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid.

Molecular Properties

Compound Name2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid
PubChem CID65282412
Molecular FormulaC15H28N2O3
Molecular Weight284.40 g/mol
Exact Mass284.21
IUPAC Name2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid
SMILESCCCCC(NC(=O)N1CCCC(C)(C)CC1)C(=O)O
InChIInChI=1S/C15H28N2O3/c1-4-5-7-12(13(18)19)16-14(20)17-10-6-8-15(2,3)9-11-17/h12H,4-11H2,1-3H3,(H,16,20)(H,18,19)
InChIKeyDJBNFLLFPNKIMN-UHFFFAOYSA-N
XLogP2.85
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.40
LogP ≤ 52.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid?
The IUPAC name of 2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid (CID 65282412) is 2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid.
What is the SMILES notation for 2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid?
The canonical SMILES for 2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid is CCCCC(NC(=O)N1CCCC(C)(C)CC1)C(=O)O.
What is the InChIKey of 2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid?
The InChIKey is DJBNFLLFPNKIMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O3/c1-4-5-7-12(13(18)19)16-14(20)17-10-6-8-15(2,3)9-11-17/h12H,4-11H2,1-3H3,(H,16,20)(H,18,19).
What are the key properties of 2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid?
2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid has a molecular weight of 284.40 g/mol, XLogP of 2.85, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,4-dimethylazepane-1-carbonyl)amino]hexanoic acid is sourced from PubChem (CID 65282412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).