C18H24N2O — CID 65282785
[2-(4,4-dimethylazepan-1-yl)quinolin-4-yl]methanol (PubChem CID 65282785) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is [2-(4,4-dimethylazepan-1-yl)quinolin-4-yl]methanol.
| Compound Name | [2-(4,4-dimethylazepan-1-yl)quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 65282785 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | [2-(4,4-dimethylazepan-1-yl)quinolin-4-yl]methanol |
| SMILES | CC1(C)CCCN(c2cc(CO)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C18H24N2O/c1-18(2)8-5-10-20(11-9-18)17-12-14(13-21)15-6-3-4-7-16(15)19-17/h3-4,6-7,12,21H,5,8-11,13H2,1-2H3 |
| InChIKey | QCUSACZTUSCFIH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |