About 1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol
1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol (PubChem CID 65282858) has the molecular formula C16H24ClNO
and a molecular weight of 281.83 g/mol. Its IUPAC name is 1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol.
Molecular Properties
| Compound Name | 1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol |
| PubChem CID | 65282858 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol |
| SMILES | CC(O)c1ccc(N2CCCC(C)(C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C16H24ClNO/c1-12(19)13-5-6-15(14(17)11-13)18-9-4-7-16(2,3)8-10-18/h5-6,11-12,19H,4,7-10H2,1-3H3 |
| InChIKey | YFHKCDIKUQJKKD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol?
The IUPAC name of 1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol (CID 65282858) is 1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol.
What is the SMILES notation for 1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol?
The canonical SMILES for 1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol is CC(O)c1ccc(N2CCCC(C)(C)CC2)c(Cl)c1.
What is the InChIKey of 1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol?
The InChIKey is YFHKCDIKUQJKKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24ClNO/c1-12(19)13-5-6-15(14(17)11-13)18-9-4-7-16(2,3)8-10-18/h5-6,11-12,19H,4,7-10H2,1-3H3.
What are the key properties of 1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol?
1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol has a molecular weight of 281.83 g/mol, XLogP of 4.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-chloro-4-(4,4-dimethylazepan-1-yl)phenyl]ethanol is sourced from PubChem (CID 65282858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).