C17H34BrN — CID 65283083
1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane (PubChem CID 65283083) has the molecular formula C17H34BrN and a molecular weight of 332.37 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane.
| Compound Name | 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane |
|---|---|
| PubChem CID | 65283083 |
| Molecular Formula | C17H34BrN |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane |
| SMILES | CCCC(CBr)(CCC)CN1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C17H34BrN/c1-5-8-17(14-18,9-6-2)15-19-12-7-10-16(3,4)11-13-19/h5-15H2,1-4H3 |
| InChIKey | GNGVABLUOCVVHP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|