About 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane
1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane (PubChem CID 65283083) has the molecular formula C17H34BrN
and a molecular weight of 332.37 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane.
Molecular Properties
| Compound Name | 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane |
| PubChem CID | 65283083 |
| Molecular Formula | C17H34BrN |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane |
| SMILES | CCCC(CBr)(CCC)CN1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C17H34BrN/c1-5-8-17(14-18,9-6-2)15-19-12-7-10-16(3,4)11-13-19/h5-15H2,1-4H3 |
| InChIKey | GNGVABLUOCVVHP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane?
The IUPAC name of 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane (CID 65283083) is 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane.
What is the SMILES notation for 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane?
The canonical SMILES for 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane is CCCC(CBr)(CCC)CN1CCCC(C)(C)CC1.
What is the InChIKey of 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane?
The InChIKey is GNGVABLUOCVVHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34BrN/c1-5-8-17(14-18,9-6-2)15-19-12-7-10-16(3,4)11-13-19/h5-15H2,1-4H3.
What are the key properties of 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane?
1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane has a molecular weight of 332.37 g/mol, XLogP of 5.48, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(bromomethyl)-2-propylpentyl]-4,4-dimethylazepane is sourced from PubChem (CID 65283083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).