C13H18BrNO2 — CID 65283148
(5-bromofuran-2-yl)-(4,4-dimethylazepan-1-yl)methanone (PubChem CID 65283148) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-(4,4-dimethylazepan-1-yl)methanone.
| Compound Name | (5-bromofuran-2-yl)-(4,4-dimethylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 65283148 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (5-bromofuran-2-yl)-(4,4-dimethylazepan-1-yl)methanone |
| SMILES | CC1(C)CCCN(C(=O)c2ccc(Br)o2)CC1 |
| InChI | InChI=1S/C13H18BrNO2/c1-13(2)6-3-8-15(9-7-13)12(16)10-4-5-11(14)17-10/h4-5H,3,6-9H2,1-2H3 |
| InChIKey | AQKPIKKAZUUZJB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |