C11H8BrF2NS — CID 65283255
5-(3-bromo-5-methylthiophen-2-yl)-2,4-difluoroaniline (PubChem CID 65283255) has the molecular formula C11H8BrF2NS and a molecular weight of 304.16 g/mol. Its IUPAC name is 5-(3-bromo-5-methylthiophen-2-yl)-2,4-difluoroaniline.
| Compound Name | 5-(3-bromo-5-methylthiophen-2-yl)-2,4-difluoroaniline |
|---|---|
| PubChem CID | 65283255 |
| Molecular Formula | C11H8BrF2NS |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 302.95 |
| IUPAC Name | 5-(3-bromo-5-methylthiophen-2-yl)-2,4-difluoroaniline |
| SMILES | Cc1cc(Br)c(-c2cc(N)c(F)cc2F)s1 |
| InChI | InChI=1S/C11H8BrF2NS/c1-5-2-7(12)11(16-5)6-3-10(15)9(14)4-8(6)13/h2-4H,15H2,1H3 |
| InChIKey | XXLTVFLNBGUIGF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|