C15H26N2O — CID 65283430
1-(4,4-dimethylazepan-1-yl)-1-(furan-2-yl)propan-2-amine (PubChem CID 65283430) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 1-(4,4-dimethylazepan-1-yl)-1-(furan-2-yl)propan-2-amine.
| Compound Name | 1-(4,4-dimethylazepan-1-yl)-1-(furan-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 65283430 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 1-(4,4-dimethylazepan-1-yl)-1-(furan-2-yl)propan-2-amine |
| SMILES | CC(N)C(c1ccco1)N1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C15H26N2O/c1-12(16)14(13-6-4-11-18-13)17-9-5-7-15(2,3)8-10-17/h4,6,11-12,14H,5,7-10,16H2,1-3H3 |
| InChIKey | OKBKKJUYFOWVJG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |