About [4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine
[4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine (PubChem CID 65283742) has the molecular formula C18H37N3
and a molecular weight of 295.51 g/mol. Its IUPAC name is [4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine.
Molecular Properties
| Compound Name | [4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine |
| PubChem CID | 65283742 |
| Molecular Formula | C18H37N3 |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.30 |
| IUPAC Name | [4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine |
| SMILES | CC(C)N1CCCC(CN)(N2CCCC(C)(C)CC2)CC1 |
| InChI | InChI=1S/C18H37N3/c1-16(2)20-11-6-8-18(15-19,10-13-20)21-12-5-7-17(3,4)9-14-21/h16H,5-15,19H2,1-4H3 |
| InChIKey | GSWPAIKASQPXOC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine?
The IUPAC name of [4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine (CID 65283742) is [4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine.
What is the SMILES notation for [4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine?
The canonical SMILES for [4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine is CC(C)N1CCCC(CN)(N2CCCC(C)(C)CC2)CC1.
What is the InChIKey of [4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine?
The InChIKey is GSWPAIKASQPXOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37N3/c1-16(2)20-11-6-8-18(15-19,10-13-20)21-12-5-7-17(3,4)9-14-21/h16H,5-15,19H2,1-4H3.
What are the key properties of [4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine?
[4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine has a molecular weight of 295.51 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4,4-dimethylazepan-1-yl)-1-propan-2-ylazepan-4-yl]methanamine is sourced from PubChem (CID 65283742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).