C17H27N3O — CID 65283923
N-[4-(aminomethyl)phenyl]-2-(4,4-dimethylazepan-1-yl)acetamide (PubChem CID 65283923) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-2-(4,4-dimethylazepan-1-yl)acetamide.
| Compound Name | N-[4-(aminomethyl)phenyl]-2-(4,4-dimethylazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 65283923 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-2-(4,4-dimethylazepan-1-yl)acetamide |
| SMILES | CC1(C)CCCN(CC(=O)Nc2ccc(CN)cc2)CC1 |
| InChI | InChI=1S/C17H27N3O/c1-17(2)8-3-10-20(11-9-17)13-16(21)19-15-6-4-14(12-18)5-7-15/h4-7H,3,8-13,18H2,1-2H3,(H,19,21) |
| InChIKey | YVYKDONMXHDQSL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |