6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid

C12H19NO5 — CID 65285337

IUPAC6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid
SMILESCC(CCCC(C)N1C(=O)COCC1=O)C(=O)O
InChIInChI=1S/C12H19NO5/c1-8(12(16)17)4-3-5-9(2)13-10(14)6-18-7-11(13)15/h8-9H,3-7H2,1-2H3,(H,16,17)
InChIKeyHNAPDDJSNTXLJS-UHFFFAOYSA-N
MW257.29 g/mol
LogP0.65
Rot. Bonds6

About 6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid

6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid (PubChem CID 65285337) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is 6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid.

Molecular Properties

Compound Name6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid
PubChem CID65285337
Molecular FormulaC12H19NO5
Molecular Weight257.29 g/mol
Exact Mass257.13
IUPAC Name6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid
SMILESCC(CCCC(C)N1C(=O)COCC1=O)C(=O)O
InChIInChI=1S/C12H19NO5/c1-8(12(16)17)4-3-5-9(2)13-10(14)6-18-7-11(13)15/h8-9H,3-7H2,1-2H3,(H,16,17)
InChIKeyHNAPDDJSNTXLJS-UHFFFAOYSA-N
XLogP0.65
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.29
LogP ≤ 50.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid?
The IUPAC name of 6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid (CID 65285337) is 6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid.
What is the SMILES notation for 6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid?
The canonical SMILES for 6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid is CC(CCCC(C)N1C(=O)COCC1=O)C(=O)O.
What is the InChIKey of 6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid?
The InChIKey is HNAPDDJSNTXLJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO5/c1-8(12(16)17)4-3-5-9(2)13-10(14)6-18-7-11(13)15/h8-9H,3-7H2,1-2H3,(H,16,17).
What are the key properties of 6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid?
6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid has a molecular weight of 257.29 g/mol, XLogP of 0.65, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-dioxomorpholin-4-yl)-2-methylheptanoic acid is sourced from PubChem (CID 65285337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).