C16H22FNO3 — CID 65285580
6-[(3-fluoro-4-methylbenzoyl)amino]-2-methylheptanoic acid (PubChem CID 65285580) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is 6-[(3-fluoro-4-methylbenzoyl)amino]-2-methylheptanoic acid.
| Compound Name | 6-[(3-fluoro-4-methylbenzoyl)amino]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 65285580 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 6-[(3-fluoro-4-methylbenzoyl)amino]-2-methylheptanoic acid |
| SMILES | Cc1ccc(C(=O)NC(C)CCCC(C)C(=O)O)cc1F |
| InChI | InChI=1S/C16H22FNO3/c1-10-7-8-13(9-14(10)17)15(19)18-12(3)6-4-5-11(2)16(20)21/h7-9,11-12H,4-6H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | YEYKSQREJQNVGJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |