About 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid
6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid (PubChem CID 65285613) has the molecular formula C13H19N3O5
and a molecular weight of 297.31 g/mol. Its IUPAC name is 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid.
Molecular Properties
| Compound Name | 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid |
| PubChem CID | 65285613 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid |
| SMILES | CC(CCCC(C)C(=O)O)NC(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H19N3O5/c1-7(12(19)20)4-3-5-8(2)15-10(17)9-6-14-13(21)16-11(9)18/h6-8H,3-5H2,1-2H3,(H,15,17)(H,19,20)(H2,14,16,18,21) |
| InChIKey | PXJPOKJKHLJIJF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid?
The IUPAC name of 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid (CID 65285613) is 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid.
What is the SMILES notation for 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid?
The canonical SMILES for 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid is CC(CCCC(C)C(=O)O)NC(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid?
The InChIKey is PXJPOKJKHLJIJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O5/c1-7(12(19)20)4-3-5-8(2)15-10(17)9-6-14-13(21)16-11(9)18/h6-8H,3-5H2,1-2H3,(H,15,17)(H,19,20)(H2,14,16,18,21).
What are the key properties of 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid?
6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid has a molecular weight of 297.31 g/mol, XLogP of 0.07, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-2-methylheptanoic acid is sourced from PubChem (CID 65285613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).