C16H30N2O3 — CID 65286080
4,4-dimethyl-6-(3-piperidin-3-ylpropanoylamino)hexanoic acid (PubChem CID 65286080) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is 4,4-dimethyl-6-(3-piperidin-3-ylpropanoylamino)hexanoic acid.
| Compound Name | 4,4-dimethyl-6-(3-piperidin-3-ylpropanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 65286080 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 4,4-dimethyl-6-(3-piperidin-3-ylpropanoylamino)hexanoic acid |
| SMILES | CC(C)(CCNC(=O)CCC1CCCNC1)CCC(=O)O |
| InChI | InChI=1S/C16H30N2O3/c1-16(2,8-7-15(20)21)9-11-18-14(19)6-5-13-4-3-10-17-12-13/h13,17H,3-12H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | CMOURXDOPGMJHV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |