About cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine
cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine (PubChem CID 65286944) has the molecular formula C15H28N2
and a molecular weight of 236.40 g/mol. Its IUPAC name is cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine.
Molecular Properties
| Compound Name | cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine |
| PubChem CID | 65286944 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine |
| SMILES | [H]/N=C(\C1CCCCC1)N1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C15H28N2/c1-15(2)9-6-11-17(12-10-15)14(16)13-7-4-3-5-8-13/h13,16H,3-12H2,1-2H3/b16-14+ |
| InChIKey | LNDJELBDWMDIJC-JQIJEIRASA-N |
| XLogP | 4.06 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine?
The IUPAC name of cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine (CID 65286944) is cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine.
What is the SMILES notation for cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine?
The canonical SMILES for cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine is [H]/N=C(\C1CCCCC1)N1CCCC(C)(C)CC1.
What is the InChIKey of cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine?
The InChIKey is LNDJELBDWMDIJC-JQIJEIRASA-N. The full InChI is InChI=1S/C15H28N2/c1-15(2)9-6-11-17(12-10-15)14(16)13-7-4-3-5-8-13/h13,16H,3-12H2,1-2H3/b16-14+.
What are the key properties of cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine?
cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine has a molecular weight of 236.40 g/mol, XLogP of 4.06, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(4,4-dimethylazepan-1-yl)methanimine is sourced from PubChem (CID 65286944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).