C15H27N3O3 — CID 65287300
6-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylamino]-4,4-dimethylhexanoic acid (PubChem CID 65287300) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is 6-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylamino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylamino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 65287300 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 6-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methylamino]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNCc1noc(C(C)(C)C)n1)CCC(=O)O |
| InChI | InChI=1S/C15H27N3O3/c1-14(2,3)13-17-11(18-21-13)10-16-9-8-15(4,5)7-6-12(19)20/h16H,6-10H2,1-5H3,(H,19,20) |
| InChIKey | ZDHUHWQKMPOHPL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|