About 6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid
6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid (PubChem CID 65287398) has the molecular formula C16H24FNO2S
and a molecular weight of 313.44 g/mol. Its IUPAC name is 6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid |
| PubChem CID | 65287398 |
| Molecular Formula | C16H24FNO2S |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNCCSc1ccccc1F)CCC(=O)O |
| InChI | InChI=1S/C16H24FNO2S/c1-16(2,8-7-15(19)20)9-10-18-11-12-21-14-6-4-3-5-13(14)17/h3-6,18H,7-12H2,1-2H3,(H,19,20) |
| InChIKey | BNLHBRXGLQBSST-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid?
The IUPAC name of 6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid (CID 65287398) is 6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid.
What is the SMILES notation for 6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid?
The canonical SMILES for 6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid is CC(C)(CCNCCSc1ccccc1F)CCC(=O)O.
What is the InChIKey of 6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid?
The InChIKey is BNLHBRXGLQBSST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24FNO2S/c1-16(2,8-7-15(19)20)9-10-18-11-12-21-14-6-4-3-5-13(14)17/h3-6,18H,7-12H2,1-2H3,(H,19,20).
What are the key properties of 6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid?
6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid has a molecular weight of 313.44 g/mol, XLogP of 3.79, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(2-fluorophenyl)sulfanylethylamino]-4,4-dimethylhexanoic acid is sourced from PubChem (CID 65287398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).