C15H16N2O2 — CID 65287939
N-[[2-(1-benzofuran-2-yl)-1,3-oxazol-4-yl]methyl]propan-1-amine (PubChem CID 65287939) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is N-[[2-(1-benzofuran-2-yl)-1,3-oxazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(1-benzofuran-2-yl)-1,3-oxazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 65287939 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-[[2-(1-benzofuran-2-yl)-1,3-oxazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1coc(-c2cc3ccccc3o2)n1 |
| InChI | InChI=1S/C15H16N2O2/c1-2-7-16-9-12-10-18-15(17-12)14-8-11-5-3-4-6-13(11)19-14/h3-6,8,10,16H,2,7,9H2,1H3 |
| InChIKey | HHPBRLRNZJYPFP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|