C16H30N2O3 — CID 65290004
6-[(4-ethylpiperidine-1-carbonyl)amino]-4,4-dimethylhexanoic acid (PubChem CID 65290004) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is 6-[(4-ethylpiperidine-1-carbonyl)amino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(4-ethylpiperidine-1-carbonyl)amino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 65290004 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 6-[(4-ethylpiperidine-1-carbonyl)amino]-4,4-dimethylhexanoic acid |
| SMILES | CCC1CCN(C(=O)NCCC(C)(C)CCC(=O)O)CC1 |
| InChI | InChI=1S/C16H30N2O3/c1-4-13-6-11-18(12-7-13)15(21)17-10-9-16(2,3)8-5-14(19)20/h13H,4-12H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | HYHUGJLHTAWJGY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |