C13H19N5O3 — CID 652907
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N,N-diethylacetamide (PubChem CID 652907) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N,N-diethylacetamide.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 652907 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cn1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C13H19N5O3/c1-5-17(6-2)9(19)7-18-8-14-11-10(18)12(20)16(4)13(21)15(11)3/h8H,5-7H2,1-4H3 |
| InChIKey | HRIJEJDKCKJHEG-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |