C17H28N2O — CID 65291071
6-amino-N-(3,5-dimethylphenyl)-N,4,4-trimethylhexanamide (PubChem CID 65291071) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 6-amino-N-(3,5-dimethylphenyl)-N,4,4-trimethylhexanamide.
| Compound Name | 6-amino-N-(3,5-dimethylphenyl)-N,4,4-trimethylhexanamide |
|---|---|
| PubChem CID | 65291071 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 6-amino-N-(3,5-dimethylphenyl)-N,4,4-trimethylhexanamide |
| SMILES | Cc1cc(C)cc(N(C)C(=O)CCC(C)(C)CCN)c1 |
| InChI | InChI=1S/C17H28N2O/c1-13-10-14(2)12-15(11-13)19(5)16(20)6-7-17(3,4)8-9-18/h10-12H,6-9,18H2,1-5H3 |
| InChIKey | CDBCTKUVWLKUCQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |