About 6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide
6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide (PubChem CID 65292006) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is 6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide.
Molecular Properties
| Compound Name | 6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide |
| PubChem CID | 65292006 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide |
| SMILES | CC(C)(CCN)CCC(=O)N(CCC#N)C1CC1 |
| InChI | InChI=1S/C14H25N3O/c1-14(2,8-10-16)7-6-13(18)17(11-3-9-15)12-4-5-12/h12H,3-8,10-11,16H2,1-2H3 |
| InChIKey | FITYRGACZHTYNP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide?
The IUPAC name of 6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide (CID 65292006) is 6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide.
What is the SMILES notation for 6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide?
The canonical SMILES for 6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide is CC(C)(CCN)CCC(=O)N(CCC#N)C1CC1.
What is the InChIKey of 6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide?
The InChIKey is FITYRGACZHTYNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O/c1-14(2,8-10-16)7-6-13(18)17(11-3-9-15)12-4-5-12/h12H,3-8,10-11,16H2,1-2H3.
What are the key properties of 6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide?
6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide has a molecular weight of 251.37 g/mol, XLogP of 2.05, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,4-dimethylhexanamide is sourced from PubChem (CID 65292006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).