About N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine
N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine (PubChem CID 65293875) has the molecular formula C18H33N3
and a molecular weight of 291.48 g/mol. Its IUPAC name is N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine |
| PubChem CID | 65293875 |
| Molecular Formula | C18H33N3 |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.27 |
| IUPAC Name | N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine |
| SMILES | Cc1nc(CC(C)C)nc(C)c1CC(C)CNC(C)(C)C |
| InChI | InChI=1S/C18H33N3/c1-12(2)9-17-20-14(4)16(15(5)21-17)10-13(3)11-19-18(6,7)8/h12-13,19H,9-11H2,1-8H3 |
| InChIKey | OPNRHLUXIYWXEC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine?
The IUPAC name of N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine (CID 65293875) is N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine.
What is the SMILES notation for N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine?
The canonical SMILES for N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine is Cc1nc(CC(C)C)nc(C)c1CC(C)CNC(C)(C)C.
What is the InChIKey of N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine?
The InChIKey is OPNRHLUXIYWXEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33N3/c1-12(2)9-17-20-14(4)16(15(5)21-17)10-13(3)11-19-18(6,7)8/h12-13,19H,9-11H2,1-8H3.
What are the key properties of N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine?
N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine has a molecular weight of 291.48 g/mol, XLogP of 3.86, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3-[4,6-dimethyl-2-(2-methylpropyl)pyrimidin-5-yl]-2-methylpropan-1-amine is sourced from PubChem (CID 65293875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).