About 5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine
5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine (PubChem CID 65295488) has the molecular formula C16H25N3O
and a molecular weight of 275.40 g/mol. Its IUPAC name is 5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine.
Molecular Properties
| Compound Name | 5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine |
| PubChem CID | 65295488 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine |
| SMILES | CCOC1CC(Nc2ccc(N(C)C)nc2)C12CCC2 |
| InChI | InChI=1S/C16H25N3O/c1-4-20-14-10-13(16(14)8-5-9-16)18-12-6-7-15(17-11-12)19(2)3/h6-7,11,13-14,18H,4-5,8-10H2,1-3H3 |
| InChIKey | DSQBBHSDAVDJEW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine?
The IUPAC name of 5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine (CID 65295488) is 5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine.
What is the SMILES notation for 5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine?
The canonical SMILES for 5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine is CCOC1CC(Nc2ccc(N(C)C)nc2)C12CCC2.
What is the InChIKey of 5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine?
The InChIKey is DSQBBHSDAVDJEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O/c1-4-20-14-10-13(16(14)8-5-9-16)18-12-6-7-15(17-11-12)19(2)3/h6-7,11,13-14,18H,4-5,8-10H2,1-3H3.
What are the key properties of 5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine?
5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine has a molecular weight of 275.40 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(3-ethoxyspiro[3.3]heptan-1-yl)-2-N,2-N-dimethylpyridine-2,5-diamine is sourced from PubChem (CID 65295488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).