C15H32N2 — CID 65295973
N'-butyl-N'-cyclopropyl-3,3-dimethylhexane-1,6-diamine (PubChem CID 65295973) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is N'-butyl-N'-cyclopropyl-3,3-dimethylhexane-1,6-diamine.
| Compound Name | N'-butyl-N'-cyclopropyl-3,3-dimethylhexane-1,6-diamine |
|---|---|
| PubChem CID | 65295973 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | N'-butyl-N'-cyclopropyl-3,3-dimethylhexane-1,6-diamine |
| SMILES | CCCCN(CCCC(C)(C)CCN)C1CC1 |
| InChI | InChI=1S/C15H32N2/c1-4-5-12-17(14-7-8-14)13-6-9-15(2,3)10-11-16/h14H,4-13,16H2,1-3H3 |
| InChIKey | JRPSBHQWPHLVIV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |