About 6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine
6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine (PubChem CID 65296309) has the molecular formula C15H32N2O
and a molecular weight of 256.43 g/mol. Its IUPAC name is 6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | 6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine |
| PubChem CID | 65296309 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine |
| SMILES | COCC1CCN(CCCC(C)(C)CCN)CC1 |
| InChI | InChI=1S/C15H32N2O/c1-15(2,8-9-16)7-4-10-17-11-5-14(6-12-17)13-18-3/h14H,4-13,16H2,1-3H3 |
| InChIKey | UKNRYKPRJKDKBN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine?
The IUPAC name of 6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine (CID 65296309) is 6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine.
What is the SMILES notation for 6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine?
The canonical SMILES for 6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine is COCC1CCN(CCCC(C)(C)CCN)CC1.
What is the InChIKey of 6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine?
The InChIKey is UKNRYKPRJKDKBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O/c1-15(2,8-9-16)7-4-10-17-11-5-14(6-12-17)13-18-3/h14H,4-13,16H2,1-3H3.
What are the key properties of 6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine?
6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine has a molecular weight of 256.43 g/mol, XLogP of 2.50, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(methoxymethyl)piperidin-1-yl]-3,3-dimethylhexan-1-amine is sourced from PubChem (CID 65296309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).