C18H20BrF — CID 65296612
5-(1-bromo-2-phenylbutyl)-2-fluoro-1,3-dimethylbenzene (PubChem CID 65296612) has the molecular formula C18H20BrF and a molecular weight of 335.26 g/mol. Its IUPAC name is 5-(1-bromo-2-phenylbutyl)-2-fluoro-1,3-dimethylbenzene.
| Compound Name | 5-(1-bromo-2-phenylbutyl)-2-fluoro-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 65296612 |
| Molecular Formula | C18H20BrF |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 5-(1-bromo-2-phenylbutyl)-2-fluoro-1,3-dimethylbenzene |
| SMILES | CCC(c1ccccc1)C(Br)c1cc(C)c(F)c(C)c1 |
| InChI | InChI=1S/C18H20BrF/c1-4-16(14-8-6-5-7-9-14)17(19)15-10-12(2)18(20)13(3)11-15/h5-11,16-17H,4H2,1-3H3 |
| InChIKey | HKGGLYQZAHUGSN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|