About 3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine
3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine (PubChem CID 652980) has the molecular formula C17H19NO4S2
and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine |
| PubChem CID | 652980 |
| Molecular Formula | C17H19NO4S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine |
| SMILES | COc1ccc(C2SCCN2S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C17H19NO4S2/c1-21-15-9-8-13(12-16(15)22-2)17-18(10-11-23-17)24(19,20)14-6-4-3-5-7-14/h3-9,12,17H,10-11H2,1-2H3 |
| InChIKey | JRVQDGBYJXWOBT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine?
The IUPAC name of 3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine (CID 652980) is 3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine.
What is the SMILES notation for 3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine?
The canonical SMILES for 3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine is COc1ccc(C2SCCN2S(=O)(=O)c2ccccc2)cc1OC.
What is the InChIKey of 3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine?
The InChIKey is JRVQDGBYJXWOBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO4S2/c1-21-15-9-8-13(12-16(15)22-2)17-18(10-11-23-17)24(19,20)14-6-4-3-5-7-14/h3-9,12,17H,10-11H2,1-2H3.
What are the key properties of 3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine?
3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine has a molecular weight of 365.48 g/mol, XLogP of 3.14, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-2-(3,4-dimethoxyphenyl)-1,3-thiazolidine is sourced from PubChem (CID 652980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).